C19H19N3 — CID 17221038
2-(1H-indol-3-yl)-N-(1H-indol-4-ylmethyl)ethanamine (PubChem CID 17221038) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(1H-indol-4-ylmethyl)ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N-(1H-indol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 17221038 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(1H-indol-4-ylmethyl)ethanamine |
| SMILES | c1ccc2c(CCNCc3cccc4[nH]ccc34)c[nH]c2c1 |
| InChI | InChI=1S/C19H19N3/c1-2-6-19-16(5-1)15(13-22-19)8-10-20-12-14-4-3-7-18-17(14)9-11-21-18/h1-7,9,11,13,20-22H,8,10,12H2 |
| InChIKey | JAIAWAOWCKYYLF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|