C15H17N3 — CID 66407834
2-(1H-indol-3-yl)-N-(1H-pyrrol-3-ylmethyl)ethanamine (PubChem CID 66407834) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(1H-pyrrol-3-ylmethyl)ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N-(1H-pyrrol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 66407834 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(1H-pyrrol-3-ylmethyl)ethanamine |
| SMILES | c1ccc2c(CCNCc3cc[nH]c3)c[nH]c2c1 |
| InChI | InChI=1S/C15H17N3/c1-2-4-15-14(3-1)13(11-18-15)6-8-17-10-12-5-7-16-9-12/h1-5,7,9,11,16-18H,6,8,10H2 |
| InChIKey | KMMXZLFSFLSURJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|