C17H19N3O2S — CID 141103412
3-[[2-(1H-indol-3-yl)ethylamino]methyl]benzenesulfonamide (PubChem CID 141103412) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-[[2-(1H-indol-3-yl)ethylamino]methyl]benzenesulfonamide.
| Compound Name | 3-[[2-(1H-indol-3-yl)ethylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141103412 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-[[2-(1H-indol-3-yl)ethylamino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CNCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C17H19N3O2S/c18-23(21,22)15-5-3-4-13(10-15)11-19-9-8-14-12-20-17-7-2-1-6-16(14)17/h1-7,10,12,19-20H,8-9,11H2,(H2,18,21,22) |
| InChIKey | COAYDGFFHYPXTN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|