C17H18N4O3S — CID 24650587
1-[2-(1H-indol-3-yl)ethyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 24650587) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 24650587 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C17H18N4O3S/c18-25(23,24)14-7-5-13(6-8-14)21-17(22)19-10-9-12-11-20-16-4-2-1-3-15(12)16/h1-8,11,20H,9-10H2,(H2,18,23,24)(H2,19,21,22) |
| InChIKey | ODYDRYZSTPMACB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |