C19H20FN3O2 — CID 166188124
1-(4-ethoxy-3-fluorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 166188124) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-(4-ethoxy-3-fluorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(4-ethoxy-3-fluorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 166188124 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(4-ethoxy-3-fluorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCc2c[nH]c3ccccc23)cc1F |
| InChI | InChI=1S/C19H20FN3O2/c1-2-25-18-8-7-14(11-16(18)20)23-19(24)21-10-9-13-12-22-17-6-4-3-5-15(13)17/h3-8,11-12,22H,2,9-10H2,1H3,(H2,21,23,24) |
| InChIKey | AWMGDLHNZPOOHT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |