C21H25N3O2 — CID 109027444
3-(4-ethoxyanilino)-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 109027444) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-(4-ethoxyanilino)-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-(4-ethoxyanilino)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 109027444 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-(4-ethoxyanilino)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | CCOc1ccc(NCCC(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-26-18-9-7-17(8-10-18)22-14-12-21(25)23-13-11-16-15-24-20-6-4-3-5-19(16)20/h3-10,15,22,24H,2,11-14H2,1H3,(H,23,25) |
| InChIKey | VCXJNCDXRFCHLJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|