C13H15ClN2O — CID 588711
3-chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 588711) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 588711 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | O=C(CCCl)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H15ClN2O/c14-7-5-13(17)15-8-6-10-9-16-12-4-2-1-3-11(10)12/h1-4,9,16H,5-8H2,(H,15,17) |
| InChIKey | OPKXWASJTNADKA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|