C17H26ClN3O — CID 75493600
7-amino-N-[2-(1H-indol-3-yl)ethyl]heptanamide;hydrochloride (PubChem CID 75493600) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 7-amino-N-[2-(1H-indol-3-yl)ethyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[2-(1H-indol-3-yl)ethyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 75493600 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 7-amino-N-[2-(1H-indol-3-yl)ethyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H25N3O.ClH/c18-11-6-2-1-3-9-17(21)19-12-10-14-13-20-16-8-5-4-7-15(14)16;/h4-5,7-8,13,20H,1-3,6,9-12,18H2,(H,19,21);1H |
| InChIKey | ZZTXVFOEQXBABD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|