C18H28ClN3O — CID 119781315
7-amino-N-[2-(7-methyl-1H-indol-3-yl)ethyl]heptanamide;hydrochloride (PubChem CID 119781315) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is 7-amino-N-[2-(7-methyl-1H-indol-3-yl)ethyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[2-(7-methyl-1H-indol-3-yl)ethyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119781315 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 7-amino-N-[2-(7-methyl-1H-indol-3-yl)ethyl]heptanamide;hydrochloride |
| SMILES | Cc1cccc2c(CCNC(=O)CCCCCCN)c[nH]c12.Cl |
| InChI | InChI=1S/C18H27N3O.ClH/c1-14-7-6-8-16-15(13-21-18(14)16)10-12-20-17(22)9-4-2-3-5-11-19;/h6-8,13,21H,2-5,9-12,19H2,1H3,(H,20,22);1H |
| InChIKey | LLKIKACJEBEEBS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|