C16H23N3O2S — CID 97318805
1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[3-[(S)-methylsulfinyl]propyl]urea (PubChem CID 97318805) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[3-[(S)-methylsulfinyl]propyl]urea.
| Compound Name | 1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[3-[(S)-methylsulfinyl]propyl]urea |
|---|---|
| PubChem CID | 97318805 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[3-[(S)-methylsulfinyl]propyl]urea |
| SMILES | Cc1cccc2c(CCNC(=O)NCCC[S@](C)=O)c[nH]c12 |
| InChI | InChI=1S/C16H23N3O2S/c1-12-5-3-6-14-13(11-19-15(12)14)7-9-18-16(20)17-8-4-10-22(2)21/h3,5-6,11,19H,4,7-10H2,1-2H3,(H2,17,18,20)/t22-/m0/s1 |
| InChIKey | FZMBRTAPDUWSNU-QFIPXVFZSA-N |
| XLogP | 2.09 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|