C17H25N3O2 — CID 111506685
1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-(7-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 111506685) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-(7-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-(7-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 111506685 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-(7-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | Cc1cccc2c(CCNC(=O)NC(C)C(C)CO)c[nH]c12 |
| InChI | InChI=1S/C17H25N3O2/c1-11-5-4-6-15-14(9-19-16(11)15)7-8-18-17(22)20-13(3)12(2)10-21/h4-6,9,12-13,19,21H,7-8,10H2,1-3H3,(H2,18,20,22) |
| InChIKey | DCERQPHXVCUYNB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |