C27H42N2O — CID 171117124
(Z)-N-[2-(1H-indol-3-yl)ethyl]heptadec-9-enamide (PubChem CID 171117124) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is (Z)-N-[2-(1H-indol-3-yl)ethyl]heptadec-9-enamide.
| Compound Name | (Z)-N-[2-(1H-indol-3-yl)ethyl]heptadec-9-enamide |
|---|---|
| PubChem CID | 171117124 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | (Z)-N-[2-(1H-indol-3-yl)ethyl]heptadec-9-enamide |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-27(30)28-22-21-24-23-29-26-19-17-16-18-25(24)26/h8-9,16-19,23,29H,2-7,10-15,20-22H2,1H3,(H,28,30)/b9-8- |
| InChIKey | JDGBCGWADOJFRG-HJWRWDBZSA-N |
| XLogP | 7.47 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|