C32H46N2O — CID 171117139
(7Z,10Z,13Z,16Z)-N-[2-(1H-indol-3-yl)ethyl]docosa-7,10,13,16-tetraenamide (PubChem CID 171117139) has the molecular formula C32H46N2O and a molecular weight of 474.73 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z)-N-[2-(1H-indol-3-yl)ethyl]docosa-7,10,13,16-tetraenamide.
| Compound Name | (7Z,10Z,13Z,16Z)-N-[2-(1H-indol-3-yl)ethyl]docosa-7,10,13,16-tetraenamide |
|---|---|
| PubChem CID | 171117139 |
| Molecular Formula | C32H46N2O |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | (7Z,10Z,13Z,16Z)-N-[2-(1H-indol-3-yl)ethyl]docosa-7,10,13,16-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C32H46N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-32(35)33-27-26-29-28-34-31-24-22-21-23-30(29)31/h6-7,9-10,12-13,15-16,21-24,28,34H,2-5,8,11,14,17-20,25-27H2,1H3,(H,33,35)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | GBJDOITVXUISHY-DOFZRALJSA-N |
| XLogP | 8.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|