C31H46N2O4 — CID 172515400
1-[2-(1H-indol-3-yl)ethylcarbamoyloxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 172515400) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethylcarbamoyloxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 1-[2-(1H-indol-3-yl)ethylcarbamoyloxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 172515400 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethylcarbamoyloxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(C)OC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H46N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-30(34)36-26(2)37-31(35)32-24-23-27-25-33-29-21-19-18-20-28(27)29/h7-8,10-11,18-21,25-26,33H,3-6,9,12-17,22-24H2,1-2H3,(H,32,35)/b8-7-,11-10- |
| InChIKey | DPDGNEMNDNIPEO-NQLNTKRDSA-N |
| XLogP | 8.14 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|