C38H66O4 — CID 141440294
1-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 141440294) has the molecular formula C38H66O4 and a molecular weight of 586.94 g/mol. Its IUPAC name is 1-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 1-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 141440294 |
| Molecular Formula | C38H66O4 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 586.50 |
| IUPAC Name | 1-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(C)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C38H66O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37(39)41-36(3)42-38(40)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,36H,4-11,16-17,22-35H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | DROGZIXCEMFKFF-QYCRHRGJSA-N |
| XLogP | 12.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|