C24H43BrO2 — CID 134388270
[(11Z,14Z)-icosa-11,14-dien-2-yl] 4-bromobutanoate (PubChem CID 134388270) has the molecular formula C24H43BrO2 and a molecular weight of 443.51 g/mol. Its IUPAC name is [(11Z,14Z)-icosa-11,14-dien-2-yl] 4-bromobutanoate.
| Compound Name | [(11Z,14Z)-icosa-11,14-dien-2-yl] 4-bromobutanoate |
|---|---|
| PubChem CID | 134388270 |
| Molecular Formula | C24H43BrO2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(11Z,14Z)-icosa-11,14-dien-2-yl] 4-bromobutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(C)OC(=O)CCCBr |
| InChI | InChI=1S/C24H43BrO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(2)27-24(26)21-19-22-25/h7-8,10-11,23H,3-6,9,12-22H2,1-2H3/b8-7-,11-10- |
| InChIKey | AADQKBCYJDUOKU-NQLNTKRDSA-N |
| XLogP | 8.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|