C23H38O3 — CID 173105709
1-methoxyethyl icosa-5,8,11,14-tetraenoate (PubChem CID 173105709) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 1-methoxyethyl icosa-5,8,11,14-tetraenoate.
| Compound Name | 1-methoxyethyl icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 173105709 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-methoxyethyl icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(C)OC |
| InChI | InChI=1S/C23H38O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(24)26-22(2)25-3/h8-9,11-12,14-15,17-18,22H,4-7,10,13,16,19-21H2,1-3H3 |
| InChIKey | WUYDWFYVMYYRIF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|