C21H40O4 — CID 87479246
1-methoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 87479246) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-methoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | 1-methoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 87479246 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1-methoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC(C)OC |
| InChI | InChI=1S/C21H40O4/c1-4-5-6-13-16-20(22)17-14-11-9-7-8-10-12-15-18-21(23)25-19(2)24-3/h11,14,19-20,22H,4-10,12-13,15-18H2,1-3H3/b14-11-/t19?,20-/m1/s1 |
| InChIKey | XBWVOZVKLMJPCN-BBMDZZGQSA-N |
| XLogP | 5.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|