C23H44O4 — CID 87553530
1-ethoxypropyl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 87553530) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is 1-ethoxypropyl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | 1-ethoxypropyl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 87553530 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 1-ethoxypropyl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC(CC)OCC |
| InChI | InChI=1S/C23H44O4/c1-4-7-8-15-18-21(24)19-16-13-11-9-10-12-14-17-20-22(25)27-23(5-2)26-6-3/h13,16,21,23-24H,4-12,14-15,17-20H2,1-3H3/b16-13-/t21-,23?/m1/s1 |
| InChIKey | LFHGCYLXNPMIAI-VJXKLFSBSA-N |
| XLogP | 6.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|