C24H40O2 — CID 58356949
2-methylpropyl (8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 58356949) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-methylpropyl (8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | 2-methylpropyl (8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 58356949 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2-methylpropyl (8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC=CCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C24H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(25)26-22-23(2)3/h8-9,11-12,14-15,17-18,23H,4-7,10,13,16,19-22H2,1-3H3/b9-8-,12-11-,15-14-,18-17? |
| InChIKey | FUQSFQARZYWNKH-QCLNILTCSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|