C40H62O4 — CID 54235678
icosa-5,8,11,14-tetraenoyl icosa-5,8,11,14-tetraeneperoxoate (PubChem CID 54235678) has the molecular formula C40H62O4 and a molecular weight of 606.93 g/mol. Its IUPAC name is icosa-5,8,11,14-tetraenoyl icosa-5,8,11,14-tetraeneperoxoate.
| Compound Name | icosa-5,8,11,14-tetraenoyl icosa-5,8,11,14-tetraeneperoxoate |
|---|---|
| PubChem CID | 54235678 |
| Molecular Formula | C40H62O4 |
| Molecular Weight | 606.93 g/mol |
| Exact Mass | 606.46 |
| IUPAC Name | icosa-5,8,11,14-tetraenoyl icosa-5,8,11,14-tetraeneperoxoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OOC(=O)CCCC=CCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C40H62O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(41)43-44-40(42)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,23-26,29-32H,3-10,15-16,21-22,27-28,33-38H2,1-2H3 |
| InChIKey | QMJXWEAZRJKRML-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.93 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|