C20H35NO4 — CID 171919221
(2-aminoacetyl) (9Z,12Z)-octadeca-9,12-dieneperoxoate (PubChem CID 171919221) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is (2-aminoacetyl) (9Z,12Z)-octadeca-9,12-dieneperoxoate.
| Compound Name | (2-aminoacetyl) (9Z,12Z)-octadeca-9,12-dieneperoxoate |
|---|---|
| PubChem CID | 171919221 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | (2-aminoacetyl) (9Z,12Z)-octadeca-9,12-dieneperoxoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OOC(=O)CN |
| InChI | InChI=1S/C20H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)24-25-20(23)18-21/h6-7,9-10H,2-5,8,11-18,21H2,1H3/b7-6-,10-9- |
| InChIKey | QVOPQZQQMYEVDA-HZJYTTRNSA-N |
| XLogP | 4.76 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|