C23H41NO5 — CID 171724483
[3-(2-aminoacetyl)oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 171724483) has the molecular formula C23H41NO5 and a molecular weight of 411.58 g/mol. Its IUPAC name is [3-(2-aminoacetyl)oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-(2-aminoacetyl)oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 171724483 |
| Molecular Formula | C23H41NO5 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | [3-(2-aminoacetyl)oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)COC(=O)CN |
| InChI | InChI=1S/C23H41NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)28-19-21(25)20-29-23(27)18-24/h6-7,9-10,21,25H,2-5,8,11-20,24H2,1H3/b7-6-,10-9- |
| InChIKey | UHDPMUHHFBTQNC-HZJYTTRNSA-N |
| XLogP | 4.21 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|