C31H50N2O2 — CID 69424703
ethyl (2S)-3-(1H-indol-3-yl)-2-[[(Z)-octadec-9-enyl]amino]propanoate (PubChem CID 69424703) has the molecular formula C31H50N2O2 and a molecular weight of 482.75 g/mol. Its IUPAC name is ethyl (2S)-3-(1H-indol-3-yl)-2-[[(Z)-octadec-9-enyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[[(Z)-octadec-9-enyl]amino]propanoate |
|---|---|
| PubChem CID | 69424703 |
| Molecular Formula | C31H50N2O2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[[(Z)-octadec-9-enyl]amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C31H50N2O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-24-32-30(31(34)35-4-2)25-27-26-33-29-23-20-19-22-28(27)29/h11-12,19-20,22-23,26,30,32-33H,3-10,13-18,21,24-25H2,1-2H3/b12-11-/t30-/m0/s1 |
| InChIKey | VUXWWSCDNWDLDY-NRESKRBGSA-N |
| XLogP | 8.27 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|