C32H46N4O3 — CID 159813673
3-(1H-indol-3-yl)-N-pentylpropanamide;3-(1H-indol-3-yl)propanoic acid;pentan-1-amine (PubChem CID 159813673) has the molecular formula C32H46N4O3 and a molecular weight of 534.75 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-pentylpropanamide;3-(1H-indol-3-yl)propanoic acid;pentan-1-amine.
| Compound Name | 3-(1H-indol-3-yl)-N-pentylpropanamide;3-(1H-indol-3-yl)propanoic acid;pentan-1-amine |
|---|---|
| PubChem CID | 159813673 |
| Molecular Formula | C32H46N4O3 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-pentylpropanamide;3-(1H-indol-3-yl)propanoic acid;pentan-1-amine |
| SMILES | CCCCCN.CCCCCNC(=O)CCc1c[nH]c2ccccc12.O=C(O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H22N2O.C11H11NO2.C5H13N/c1-2-3-6-11-17-16(19)10-9-13-12-18-15-8-5-4-7-14(13)15;13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10;1-2-3-4-5-6/h4-5,7-8,12,18H,2-3,6,9-11H2,1H3,(H,17,19);1-4,7,12H,5-6H2,(H,13,14);2-6H2,1H3 |
| InChIKey | NLIRJPCDNLINHL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|