C21H23N3O3 — CID 112993925
N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-3-phenoxypropanamide (PubChem CID 112993925) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-3-phenoxypropanamide.
| Compound Name | N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 112993925 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)NCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c25-20(11-13-27-17-6-2-1-3-7-17)24-15-21(26)22-12-10-16-14-23-19-9-5-4-8-18(16)19/h1-9,14,23H,10-13,15H2,(H,22,26)(H,24,25) |
| InChIKey | CVMBCVLQVGGWRV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |