C20H20N2O4 — CID 9018351
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-phenoxyacetate (PubChem CID 9018351) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-phenoxyacetate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 9018351 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-phenoxyacetate |
| SMILES | O=C(COC(=O)COc1ccccc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O4/c23-19(13-26-20(24)14-25-16-6-2-1-3-7-16)21-11-10-15-12-22-18-9-5-4-8-17(15)18/h1-9,12,22H,10-11,13-14H2,(H,21,23) |
| InChIKey | OGBDLVLNMOVLQX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |