C19H24N2O3 — CID 9017170
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 9017170) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 9017170 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCCC1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H24N2O3/c22-18(13-24-19(23)14-6-2-1-3-7-14)20-11-10-15-12-21-17-9-5-4-8-16(15)17/h4-5,8-9,12,14,21H,1-3,6-7,10-11,13H2,(H,20,22) |
| InChIKey | OEZCZLSWZHMTCD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |