C20H20N2O3 — CID 9202567
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-methylbenzoate (PubChem CID 9202567) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-methylbenzoate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 9202567 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O3/c1-14-6-2-3-7-16(14)20(24)25-13-19(23)21-11-10-15-12-22-18-9-5-4-8-17(15)18/h2-9,12,22H,10-11,13H2,1H3,(H,21,23) |
| InChIKey | HVFYYOJDGYINKG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |