C22H23N3O4 — CID 18202739
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 18202739) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 18202739 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)OCC(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-15(26)24-12-16-6-8-17(9-7-16)22(28)29-14-21(27)23-11-10-18-13-25-20-5-3-2-4-19(18)20/h2-9,13,25H,10-12,14H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | MZSMFNQPOKMOGD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |