C24H26N2O5 — CID 8653138
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate (PubChem CID 8653138) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 8653138 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC[C@@H]2CCCO2)cc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H26N2O5/c27-23(25-12-11-18-14-26-22-6-2-1-5-21(18)22)16-31-24(28)17-7-9-19(10-8-17)30-15-20-4-3-13-29-20/h1-2,5-10,14,20,26H,3-4,11-13,15-16H2,(H,25,27)/t20-/m0/s1 |
| InChIKey | BVYCDEWCAHMXQZ-FQEVSTJZSA-N |
| XLogP | 3.24 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |