C18H23N3O3 — CID 108943642
N-[2-(1H-indol-3-yl)ethyl]-N'-(oxolan-2-ylmethyl)propanediamide (PubChem CID 108943642) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-(oxolan-2-ylmethyl)propanediamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-(oxolan-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108943642 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-(oxolan-2-ylmethyl)propanediamide |
| SMILES | O=C(CC(=O)NCC1CCCO1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H23N3O3/c22-17(10-18(23)21-12-14-4-3-9-24-14)19-8-7-13-11-20-16-6-2-1-5-15(13)16/h1-2,5-6,11,14,20H,3-4,7-10,12H2,(H,19,22)(H,21,23) |
| InChIKey | RJEAXKRZYHZQMZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|