C17H24N2O3 — CID 7303399
N'-[[(2S)-oxolan-2-yl]methyl]-N-(2-phenylethyl)butanediamide (PubChem CID 7303399) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-[[(2S)-oxolan-2-yl]methyl]-N-(2-phenylethyl)butanediamide.
| Compound Name | N'-[[(2S)-oxolan-2-yl]methyl]-N-(2-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 7303399 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N'-[[(2S)-oxolan-2-yl]methyl]-N-(2-phenylethyl)butanediamide |
| SMILES | O=C(CCC(=O)NC[C@@H]1CCCO1)NCCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c20-16(18-11-10-14-5-2-1-3-6-14)8-9-17(21)19-13-15-7-4-12-22-15/h1-3,5-6,15H,4,7-13H2,(H,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | ABCSMDWPNAEWBX-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |