C21H24N2O3 — CID 7324082
N-[[(2R)-oxolan-2-yl]methyl]-N',N'-diphenylbutanediamide (PubChem CID 7324082) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N',N'-diphenylbutanediamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N',N'-diphenylbutanediamide |
|---|---|
| PubChem CID | 7324082 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N',N'-diphenylbutanediamide |
| SMILES | O=C(CCC(=O)N(c1ccccc1)c1ccccc1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C21H24N2O3/c24-20(22-16-19-12-7-15-26-19)13-14-21(25)23(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | SGJHTGXEQNJZME-LJQANCHMSA-N |
| XLogP | 3.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |