C13H17NO3S — CID 2530381
4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-4-thiophen-2-ylbutanamide (PubChem CID 2530381) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-4-thiophen-2-ylbutanamide.
| Compound Name | 4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 2530381 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H17NO3S/c15-11(12-4-2-8-18-12)5-6-13(16)14-9-10-3-1-7-17-10/h2,4,8,10H,1,3,5-7,9H2,(H,14,16)/t10-/m1/s1 |
| InChIKey | IQNDSCCNDCOPLV-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |