C13H17NO4S — CID 1470109
[(2R)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]propan-2-yl] thiophene-2-carboxylate (PubChem CID 1470109) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]propan-2-yl] thiophene-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]propan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1470109 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [(2R)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]propan-2-yl] thiophene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cccs1)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H17NO4S/c1-9(18-13(16)11-5-3-7-19-11)12(15)14-8-10-4-2-6-17-10/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | NEJNAWGNVCSTOH-ZJUUUORDSA-N |
| XLogP | 1.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |