C11H16N2OS — CID 95591821
N'-methyl-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboximidamide (PubChem CID 95591821) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N'-methyl-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboximidamide.
| Compound Name | N'-methyl-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 95591821 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N'-methyl-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboximidamide |
| SMILES | C/N=C(\NC[C@@H]1CCCO1)c1cccs1 |
| InChI | InChI=1S/C11H16N2OS/c1-12-11(10-5-3-7-15-10)13-8-9-4-2-6-14-9/h3,5,7,9H,2,4,6,8H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | YVIHOWJKDRYKQK-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|