C16H23NO4S — CID 1470140
[(2S)-4-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl] thiophene-2-carboxylate (PubChem CID 1470140) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is [(2S)-4-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl] thiophene-2-carboxylate.
| Compound Name | [(2S)-4-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1470140 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(2S)-4-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl] thiophene-2-carboxylate |
| SMILES | CC(C)C[C@H](OC(=O)c1cccs1)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H23NO4S/c1-11(2)9-13(21-16(19)14-6-4-8-22-14)15(18)17-10-12-5-3-7-20-12/h4,6,8,11-13H,3,5,7,9-10H2,1-2H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | AEFGPJJTDXJVLW-STQMWFEESA-N |
| XLogP | 2.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |