C14H22N2O4S2 — CID 18160350
4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 18160350) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 18160350 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | CN(CCCC(=O)NCC1CCCO1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-16(22(18,19)14-7-4-10-21-14)8-2-6-13(17)15-11-12-5-3-9-20-12/h4,7,10,12H,2-3,5-6,8-9,11H2,1H3,(H,15,17) |
| InChIKey | IEOUZNMLBHMPBY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |