C16H24N2O5S — CID 113144466
3-(2-methoxy-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 113144466) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is 3-(2-methoxy-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(2-methoxy-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113144466 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-(2-methoxy-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | COc1ccccc1N(CCC(=O)NCC1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C16H24N2O5S/c1-22-15-8-4-3-7-14(15)18(24(2,20)21)10-9-16(19)17-12-13-6-5-11-23-13/h3-4,7-8,13H,5-6,9-12H2,1-2H3,(H,17,19) |
| InChIKey | QIINCOMEVCWBNL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |