C17H26N2O5S — CID 125052199
4-(4-methoxy-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 125052199) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(4-methoxy-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 125052199 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | COc1ccc(N(CCCC(=O)NC[C@H]2CCCO2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H26N2O5S/c1-23-15-9-7-14(8-10-15)19(25(2,21)22)11-3-6-17(20)18-13-16-5-4-12-24-16/h7-10,16H,3-6,11-13H2,1-2H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | DSJHGLPPOUOLRM-MRXNPFEDSA-N |
| XLogP | 1.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |