C15H20Cl2N2O4S — CID 113146467
3-(3,4-dichloro-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 113146467) has the molecular formula C15H20Cl2N2O4S and a molecular weight of 395.31 g/mol. Its IUPAC name is 3-(3,4-dichloro-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(3,4-dichloro-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113146467 |
| Molecular Formula | C15H20Cl2N2O4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-(3,4-dichloro-N-methylsulfonylanilino)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)NCC1CCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O4S/c1-24(21,22)19(11-4-5-13(16)14(17)9-11)7-6-15(20)18-10-12-3-2-8-23-12/h4-5,9,12H,2-3,6-8,10H2,1H3,(H,18,20) |
| InChIKey | FLQAISJDALPWTM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |