C17H25ClN2O4S — CID 125059758
4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 125059758) has the molecular formula C17H25ClN2O4S and a molecular weight of 388.92 g/mol. Its IUPAC name is 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 125059758 |
| Molecular Formula | C17H25ClN2O4S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | Cc1c(Cl)cccc1N(CCCC(=O)NC[C@H]1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25ClN2O4S/c1-13-15(18)7-3-8-16(13)20(25(2,22)23)10-4-9-17(21)19-12-14-6-5-11-24-14/h3,7-8,14H,4-6,9-12H2,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | IGVUMCDBIVEQGT-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |