C15H21N3O7S — CID 2968893
2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2968893) has the molecular formula C15H21N3O7S and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2968893 |
| Molecular Formula | C15H21N3O7S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)NCC1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C15H21N3O7S/c1-24-14-6-5-11(18(20)21)8-13(14)17(26(2,22)23)10-15(19)16-9-12-4-3-7-25-12/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H,16,19) |
| InChIKey | GMIIOHCQBJIGMI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|