C19H29N3O7S — CID 30247882
N-(3-cyclohexyloxypropyl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide (PubChem CID 30247882) has the molecular formula C19H29N3O7S and a molecular weight of 443.52 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 30247882 |
| Molecular Formula | C19H29N3O7S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)NCCCOC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C19H29N3O7S/c1-28-18-10-9-15(22(24)25)13-17(18)21(30(2,26)27)14-19(23)20-11-6-12-29-16-7-4-3-5-8-16/h9-10,13,16H,3-8,11-12,14H2,1-2H3,(H,20,23) |
| InChIKey | TUXWLGQVWOCDCV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|