C21H27N3O6S2 — CID 30247845
2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30247845) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30247845 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)NCCCSCc1cccc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H27N3O6S2/c1-16-6-4-7-17(12-16)15-31-11-5-10-22-21(25)14-23(32(3,28)29)19-13-18(24(26)27)8-9-20(19)30-2/h4,6-9,12-13H,5,10-11,14-15H2,1-3H3,(H,22,25) |
| InChIKey | DGEXGSLGUOMCOK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|