C22H30N2O5S2 — CID 30220896
2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30220896) has the molecular formula C22H30N2O5S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30220896 |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCCSCc2cccc(C)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H30N2O5S2/c1-17-7-5-8-18(13-17)16-30-12-6-11-23-22(25)15-24(31(4,26)27)20-14-19(28-2)9-10-21(20)29-3/h5,7-10,13-14H,6,11-12,15-16H2,1-4H3,(H,23,25) |
| InChIKey | OOFHCBLINLCSND-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|