C22H30N2O3S2 — CID 30223677
2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30223677) has the molecular formula C22H30N2O3S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30223677 |
| Molecular Formula | C22H30N2O3S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(CSCCCNC(=O)CN(c2c(C)cccc2C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H30N2O3S2/c1-17-8-5-11-20(14-17)16-28-13-7-12-23-21(25)15-24(29(4,26)27)22-18(2)9-6-10-19(22)3/h5-6,8-11,14H,7,12-13,15-16H2,1-4H3,(H,23,25) |
| InChIKey | KQOUBCYEVLUFAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|