C25H28N2O3S2 — CID 30174110
2-[N-(benzenesulfonyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30174110) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30174110 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(CSCCCNC(=O)CN(c2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H28N2O3S2/c1-21-10-8-11-22(18-21)20-31-17-9-16-26-25(28)19-27(23-12-4-2-5-13-23)32(29,30)24-14-6-3-7-15-24/h2-8,10-15,18H,9,16-17,19-20H2,1H3,(H,26,28) |
| InChIKey | BRLBHDCGQZFJNH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|