C25H27BrN2O3S2 — CID 43892379
2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43892379) has the molecular formula C25H27BrN2O3S2 and a molecular weight of 547.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43892379 |
| Molecular Formula | C25H27BrN2O3S2 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(CSCCCNC(=O)CN(c2ccc(Br)cc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27BrN2O3S2/c1-20-7-5-8-21(17-20)19-32-16-6-15-27-25(29)18-28(23-13-11-22(26)12-14-23)33(30,31)24-9-3-2-4-10-24/h2-5,7-14,17H,6,15-16,18-19H2,1H3,(H,27,29) |
| InChIKey | GXOFYHFEOPJDGH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|